C25H30ClN5O3 — CID 170198016
1-[[5-[(4-chlorophenyl)methyl]-4-(1-pyrimidin-2-ylpiperidin-4-yl)morpholin-2-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 170198016) has the molecular formula C25H30ClN5O3 and a molecular weight of 484.00 g/mol. Its IUPAC name is 1-[[5-[(4-chlorophenyl)methyl]-4-(1-pyrimidin-2-ylpiperidin-4-yl)morpholin-2-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[5-[(4-chlorophenyl)methyl]-4-(1-pyrimidin-2-ylpiperidin-4-yl)morpholin-2-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 170198016 |
| Molecular Formula | C25H30ClN5O3 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 1-[[5-[(4-chlorophenyl)methyl]-4-(1-pyrimidin-2-ylpiperidin-4-yl)morpholin-2-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CC1CN(C2CCN(c3ncccn3)CC2)C(Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C25H30ClN5O3/c26-19-4-2-18(3-5-19)14-21-17-34-22(16-31-23(32)6-7-24(31)33)15-30(21)20-8-12-29(13-9-20)25-27-10-1-11-28-25/h1-5,10-11,20-22H,6-9,12-17H2 |
| InChIKey | LTJFBYSKUXWPLY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|