C17H19ClN2O5 — CID 170308609
(2S,5S)-5-[(4-chlorophenyl)methyl]-2-[(2,5-dioxopyrrolidin-1-yl)methyl]morpholine-4-carboxylic acid (PubChem CID 170308609) has the molecular formula C17H19ClN2O5 and a molecular weight of 366.80 g/mol. Its IUPAC name is (2S,5S)-5-[(4-chlorophenyl)methyl]-2-[(2,5-dioxopyrrolidin-1-yl)methyl]morpholine-4-carboxylic acid.
| Compound Name | (2S,5S)-5-[(4-chlorophenyl)methyl]-2-[(2,5-dioxopyrrolidin-1-yl)methyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 170308609 |
| Molecular Formula | C17H19ClN2O5 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (2S,5S)-5-[(4-chlorophenyl)methyl]-2-[(2,5-dioxopyrrolidin-1-yl)methyl]morpholine-4-carboxylic acid |
| SMILES | O=C1CCC(=O)N1C[C@H]1CN(C(=O)O)[C@@H](Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C17H19ClN2O5/c18-12-3-1-11(2-4-12)7-13-10-25-14(8-19(13)17(23)24)9-20-15(21)5-6-16(20)22/h1-4,13-14H,5-10H2,(H,23,24)/t13-,14+/m0/s1 |
| InChIKey | PIZAFOYSPTWGFK-UONOGXRCSA-N |
| XLogP | 1.78 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|