C17H27Cl2N5O2S — CID 119994455
1-benzyl-N-(3-piperazin-1-ylpropyl)pyrazole-4-sulfonamide;dihydrochloride (PubChem CID 119994455) has the molecular formula C17H27Cl2N5O2S and a molecular weight of 436.41 g/mol. Its IUPAC name is 1-benzyl-N-(3-piperazin-1-ylpropyl)pyrazole-4-sulfonamide;dihydrochloride.
| Compound Name | 1-benzyl-N-(3-piperazin-1-ylpropyl)pyrazole-4-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 119994455 |
| Molecular Formula | C17H27Cl2N5O2S |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 1-benzyl-N-(3-piperazin-1-ylpropyl)pyrazole-4-sulfonamide;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(NCCCN1CCNCC1)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H25N5O2S.2ClH/c23-25(24,20-7-4-10-21-11-8-18-9-12-21)17-13-19-22(15-17)14-16-5-2-1-3-6-16;;/h1-3,5-6,13,15,18,20H,4,7-12,14H2;2*1H |
| InChIKey | YYKLPJXEOPDQJT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|