C18H14ClNO3 — CID 34131638
N-[5-chloro-2-(4-methylphenoxy)phenyl]furan-3-carboxamide (PubChem CID 34131638) has the molecular formula C18H14ClNO3 and a molecular weight of 327.77 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylphenoxy)phenyl]furan-3-carboxamide.
| Compound Name | N-[5-chloro-2-(4-methylphenoxy)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 34131638 |
| Molecular Formula | C18H14ClNO3 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[5-chloro-2-(4-methylphenoxy)phenyl]furan-3-carboxamide |
| SMILES | Cc1ccc(Oc2ccc(Cl)cc2NC(=O)c2ccoc2)cc1 |
| InChI | InChI=1S/C18H14ClNO3/c1-12-2-5-15(6-3-12)23-17-7-4-14(19)10-16(17)20-18(21)13-8-9-22-11-13/h2-11H,1H3,(H,20,21) |
| InChIKey | MMZNDLOHLDDBGN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |