C20H24ClNO4 — CID 60567428
N-[5-chloro-2-(4-methylphenoxy)phenyl]-4-(2-methoxyethoxy)butanamide (PubChem CID 60567428) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylphenoxy)phenyl]-4-(2-methoxyethoxy)butanamide.
| Compound Name | N-[5-chloro-2-(4-methylphenoxy)phenyl]-4-(2-methoxyethoxy)butanamide |
|---|---|
| PubChem CID | 60567428 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[5-chloro-2-(4-methylphenoxy)phenyl]-4-(2-methoxyethoxy)butanamide |
| SMILES | COCCOCCCC(=O)Nc1cc(Cl)ccc1Oc1ccc(C)cc1 |
| InChI | InChI=1S/C20H24ClNO4/c1-15-5-8-17(9-6-15)26-19-10-7-16(21)14-18(19)22-20(23)4-3-11-25-13-12-24-2/h5-10,14H,3-4,11-13H2,1-2H3,(H,22,23) |
| InChIKey | YBHNXHGUTOXOKJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|