C17H15F3N2O3S — CID 109062473
N-prop-2-enyl-3-[[2-(trifluoromethyl)phenyl]sulfamoyl]benzamide (PubChem CID 109062473) has the molecular formula C17H15F3N2O3S and a molecular weight of 384.38 g/mol. Its IUPAC name is N-prop-2-enyl-3-[[2-(trifluoromethyl)phenyl]sulfamoyl]benzamide.
| Compound Name | N-prop-2-enyl-3-[[2-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 109062473 |
| Molecular Formula | C17H15F3N2O3S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-prop-2-enyl-3-[[2-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
| SMILES | C=CCNC(=O)c1cccc(S(=O)(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N2O3S/c1-2-10-21-16(23)12-6-5-7-13(11-12)26(24,25)22-15-9-4-3-8-14(15)17(18,19)20/h2-9,11,22H,1,10H2,(H,21,23) |
| InChIKey | NAMCMXDCHPEINR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|