C19H18F3N3O4S — CID 55879588
N-prop-2-enyl-2-[[3-(2,2,2-trifluoroethylcarbamoyl)phenyl]sulfonylamino]benzamide (PubChem CID 55879588) has the molecular formula C19H18F3N3O4S and a molecular weight of 441.43 g/mol. Its IUPAC name is N-prop-2-enyl-2-[[3-(2,2,2-trifluoroethylcarbamoyl)phenyl]sulfonylamino]benzamide.
| Compound Name | N-prop-2-enyl-2-[[3-(2,2,2-trifluoroethylcarbamoyl)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 55879588 |
| Molecular Formula | C19H18F3N3O4S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-prop-2-enyl-2-[[3-(2,2,2-trifluoroethylcarbamoyl)phenyl]sulfonylamino]benzamide |
| SMILES | C=CCNC(=O)c1ccccc1NS(=O)(=O)c1cccc(C(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3N3O4S/c1-2-10-23-18(27)15-8-3-4-9-16(15)25-30(28,29)14-7-5-6-13(11-14)17(26)24-12-19(20,21)22/h2-9,11,25H,1,10,12H2,(H,23,27)(H,24,26) |
| InChIKey | ZRPDKPQDDCJLBD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|