C16H13F3N6O3S — CID 52700082
3-[[2-(tetrazol-1-yl)phenyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 52700082) has the molecular formula C16H13F3N6O3S and a molecular weight of 426.38 g/mol. Its IUPAC name is 3-[[2-(tetrazol-1-yl)phenyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-[[2-(tetrazol-1-yl)phenyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 52700082 |
| Molecular Formula | C16H13F3N6O3S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 3-[[2-(tetrazol-1-yl)phenyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1cccc(S(=O)(=O)Nc2ccccc2-n2cnnn2)c1 |
| InChI | InChI=1S/C16H13F3N6O3S/c17-16(18,19)9-20-15(26)11-4-3-5-12(8-11)29(27,28)22-13-6-1-2-7-14(13)25-10-21-23-24-25/h1-8,10,22H,9H2,(H,20,26) |
| InChIKey | BMHHGINPRHTANE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |