C10H7Br3F3NO3S — CID 18717059
3-(tribromomethylsulfonyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 18717059) has the molecular formula C10H7Br3F3NO3S and a molecular weight of 517.94 g/mol. Its IUPAC name is 3-(tribromomethylsulfonyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-(tribromomethylsulfonyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 18717059 |
| Molecular Formula | C10H7Br3F3NO3S |
| Molecular Weight | 517.94 g/mol |
| Exact Mass | 514.76 |
| IUPAC Name | 3-(tribromomethylsulfonyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1cccc(S(=O)(=O)C(Br)(Br)Br)c1 |
| InChI | InChI=1S/C10H7Br3F3NO3S/c11-10(12,13)21(19,20)7-3-1-2-6(4-7)8(18)17-5-9(14,15)16/h1-4H,5H2,(H,17,18) |
| InChIKey | MODPBFJWIOWQQX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.94 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|