C25H28Br6N2O8S2 — CID 164778871
3-(tribromomethylsulfonyl)-N-[3-[3-[3-[[3-(tribromomethylsulfonyl)benzoyl]amino]propoxy]propoxy]propyl]benzamide (PubChem CID 164778871) has the molecular formula C25H28Br6N2O8S2 and a molecular weight of 1028.06 g/mol. Its IUPAC name is 3-(tribromomethylsulfonyl)-N-[3-[3-[3-[[3-(tribromomethylsulfonyl)benzoyl]amino]propoxy]propoxy]propyl]benzamide.
| Compound Name | 3-(tribromomethylsulfonyl)-N-[3-[3-[3-[[3-(tribromomethylsulfonyl)benzoyl]amino]propoxy]propoxy]propyl]benzamide |
|---|---|
| PubChem CID | 164778871 |
| Molecular Formula | C25H28Br6N2O8S2 |
| Molecular Weight | 1028.06 g/mol |
| Exact Mass | 1021.64 |
| IUPAC Name | 3-(tribromomethylsulfonyl)-N-[3-[3-[3-[[3-(tribromomethylsulfonyl)benzoyl]amino]propoxy]propoxy]propyl]benzamide |
| SMILES | O=C(NCCCOCCCOCCCNC(=O)c1cccc(S(=O)(=O)C(Br)(Br)Br)c1)c1cccc(S(=O)(=O)C(Br)(Br)Br)c1 |
| InChI | InChI=1S/C25H28Br6N2O8S2/c26-24(27,28)42(36,37)20-8-1-6-18(16-20)22(34)32-10-3-12-40-14-5-15-41-13-4-11-33-23(35)19-7-2-9-21(17-19)43(38,39)25(29,30)31/h1-2,6-9,16-17H,3-5,10-15H2,(H,32,34)(H,33,35) |
| InChIKey | CRBGKCHYHMASNF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.06 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|