C10H10Br3NO5S — CID 22945090
N-(hydroxymethoxymethyl)-3-(tribromomethylsulfonyl)benzamide (PubChem CID 22945090) has the molecular formula C10H10Br3NO5S and a molecular weight of 495.97 g/mol. Its IUPAC name is N-(hydroxymethoxymethyl)-3-(tribromomethylsulfonyl)benzamide.
| Compound Name | N-(hydroxymethoxymethyl)-3-(tribromomethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 22945090 |
| Molecular Formula | C10H10Br3NO5S |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 492.78 |
| IUPAC Name | N-(hydroxymethoxymethyl)-3-(tribromomethylsulfonyl)benzamide |
| SMILES | O=C(NCOCO)c1cccc(S(=O)(=O)C(Br)(Br)Br)c1 |
| InChI | InChI=1S/C10H10Br3NO5S/c11-10(12,13)20(17,18)8-3-1-2-7(4-8)9(16)14-5-19-6-15/h1-4,15H,5-6H2,(H,14,16) |
| InChIKey | SZHWAOFMDAHDMR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|