C26H26N4O4S — CID 70655448
4-[[[4-(3-morpholin-4-ylprop-1-ynyl)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide (PubChem CID 70655448) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is 4-[[[4-(3-morpholin-4-ylprop-1-ynyl)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide.
| Compound Name | 4-[[[4-(3-morpholin-4-ylprop-1-ynyl)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 70655448 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 4-[[[4-(3-morpholin-4-ylprop-1-ynyl)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1ccc(CNS(=O)(=O)c2ccc(C#CCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O4S/c31-26(29-24-4-1-13-27-20-24)23-9-5-22(6-10-23)19-28-35(32,33)25-11-7-21(8-12-25)3-2-14-30-15-17-34-18-16-30/h1,4-13,20,28H,14-19H2,(H,29,31) |
| InChIKey | QYCHQAXKPGEXQH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|