C34H44N4O9S — CID 67641494
4-[[[4-[3-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-ynyl]phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide (PubChem CID 67641494) has the molecular formula C34H44N4O9S and a molecular weight of 684.81 g/mol. Its IUPAC name is 4-[[[4-[3-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-ynyl]phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide.
| Compound Name | 4-[[[4-[3-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-ynyl]phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 67641494 |
| Molecular Formula | C34H44N4O9S |
| Molecular Weight | 684.81 g/mol |
| Exact Mass | 684.28 |
| IUPAC Name | 4-[[[4-[3-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-ynyl]phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
| SMILES | NCCOCCOCCOCCOCCOCCOCC#Cc1ccc(S(=O)(=O)NCc2ccc(C(=O)Nc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C34H44N4O9S/c35-13-16-43-18-20-45-22-24-47-26-25-46-23-21-44-19-17-42-15-2-3-29-7-11-33(12-8-29)48(40,41)37-27-30-5-9-31(10-6-30)34(39)38-32-4-1-14-36-28-32/h1,4-12,14,28,37H,13,15-27,35H2,(H,38,39) |
| InChIKey | HWBODXDUVGMADS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 169.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.81 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|