C14H13N5O2S — CID 168607187
N-propyl-4-(1,2,2-tricyanoethenylamino)benzenesulfonamide (PubChem CID 168607187) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is N-propyl-4-(1,2,2-tricyanoethenylamino)benzenesulfonamide.
| Compound Name | N-propyl-4-(1,2,2-tricyanoethenylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 168607187 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-propyl-4-(1,2,2-tricyanoethenylamino)benzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(C#N)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C14H13N5O2S/c1-2-7-18-22(20,21)13-5-3-12(4-6-13)19-14(10-17)11(8-15)9-16/h3-6,18-19H,2,7H2,1H3 |
| InChIKey | SDLYPTQWXDDONX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|