C17H20N4O4S — CID 9077260
4-[(Z)-C-methyl-N-(3-nitroanilino)carbonimidoyl]-N-propylbenzenesulfonamide (PubChem CID 9077260) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is 4-[(Z)-C-methyl-N-(3-nitroanilino)carbonimidoyl]-N-propylbenzenesulfonamide.
| Compound Name | 4-[(Z)-C-methyl-N-(3-nitroanilino)carbonimidoyl]-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 9077260 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 4-[(Z)-C-methyl-N-(3-nitroanilino)carbonimidoyl]-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccc(/C(C)=N\Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H20N4O4S/c1-3-11-18-26(24,25)17-9-7-14(8-10-17)13(2)19-20-15-5-4-6-16(12-15)21(22)23/h4-10,12,18,20H,3,11H2,1-2H3/b19-13- |
| InChIKey | ZODJQVJFUKNGBK-UYRXBGFRSA-N |
| XLogP | 3.12 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|