C18H18N4O3 — CID 8973239
1-[4-[(Z)-C-methyl-N-(3-nitroanilino)carbonimidoyl]phenyl]pyrrolidin-2-one (PubChem CID 8973239) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 1-[4-[(Z)-C-methyl-N-(3-nitroanilino)carbonimidoyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[(Z)-C-methyl-N-(3-nitroanilino)carbonimidoyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 8973239 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[4-[(Z)-C-methyl-N-(3-nitroanilino)carbonimidoyl]phenyl]pyrrolidin-2-one |
| SMILES | C/C(=N/Nc1cccc([N+](=O)[O-])c1)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H18N4O3/c1-13(19-20-15-4-2-5-17(12-15)22(24)25)14-7-9-16(10-8-14)21-11-3-6-18(21)23/h2,4-5,7-10,12,20H,3,6,11H2,1H3/b19-13- |
| InChIKey | YFFGTEQZVITSFY-UYRXBGFRSA-N |
| XLogP | 3.56 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|