C16H19ClN4O4 — CID 135577156
N-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide (PubChem CID 135577156) has the molecular formula C16H19ClN4O4 and a molecular weight of 366.81 g/mol. Its IUPAC name is N-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide.
| Compound Name | N-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 135577156 |
| Molecular Formula | C16H19ClN4O4 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| SMILES | C/C(=N\NC(=O)CCN1C(=O)NC(C)(C)C1=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H19ClN4O4/c1-9(11-8-10(17)4-5-12(11)22)19-20-13(23)6-7-21-14(24)16(2,3)18-15(21)25/h4-5,8,22H,6-7H2,1-3H3,(H,18,25)(H,20,23)/b19-9+ |
| InChIKey | DNEQWRBPCQQRHZ-DJKKODMXSA-N |
| XLogP | 1.61 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|