C33H29N3O2 — CID 135613957
3-(2,3-diphenylindol-1-yl)-N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]propanamide (PubChem CID 135613957) has the molecular formula C33H29N3O2 and a molecular weight of 499.61 g/mol. Its IUPAC name is 3-(2,3-diphenylindol-1-yl)-N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]propanamide.
| Compound Name | 3-(2,3-diphenylindol-1-yl)-N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135613957 |
| Molecular Formula | C33H29N3O2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 3-(2,3-diphenylindol-1-yl)-N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]propanamide |
| SMILES | C=CCc1cccc(/C=N/NC(=O)CCn2c(-c3ccccc3)c(-c3ccccc3)c3ccccc32)c1O |
| InChI | InChI=1S/C33H29N3O2/c1-2-12-26-17-11-18-27(33(26)38)23-34-35-30(37)21-22-36-29-20-10-9-19-28(29)31(24-13-5-3-6-14-24)32(36)25-15-7-4-8-16-25/h2-11,13-20,23,38H,1,12,21-22H2,(H,35,37)/b34-23+ |
| InChIKey | OMTSXNFECRDDRR-PPFNPFNJSA-N |
| XLogP | 6.95 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|