C22H19N3O2 — CID 135495779
3-carbazol-9-yl-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 135495779) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-carbazol-9-yl-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-carbazol-9-yl-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135495779 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-carbazol-9-yl-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | O=C(CCn1c2ccccc2c2ccccc21)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C22H19N3O2/c26-21-12-6-1-7-16(21)15-23-24-22(27)13-14-25-19-10-4-2-8-17(19)18-9-3-5-11-20(18)25/h1-12,15,26H,13-14H2,(H,24,27)/b23-15+ |
| InChIKey | ILUQAJIMKXNNPY-HZHRSRAPSA-N |
| XLogP | 4.04 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|