C24H22N4O2 — CID 136689088
3-(2-benzylbenzimidazol-1-yl)-N-[(Z)-(2-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 136689088) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-(2-benzylbenzimidazol-1-yl)-N-[(Z)-(2-hydroxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(2-benzylbenzimidazol-1-yl)-N-[(Z)-(2-hydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 136689088 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-(2-benzylbenzimidazol-1-yl)-N-[(Z)-(2-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | O=C(CCn1c(Cc2ccccc2)nc2ccccc21)N/N=C\c1ccccc1O |
| InChI | InChI=1S/C24H22N4O2/c29-22-13-7-4-10-19(22)17-25-27-24(30)14-15-28-21-12-6-5-11-20(21)26-23(28)16-18-8-2-1-3-9-18/h1-13,17,29H,14-16H2,(H,27,30)/b25-17- |
| InChIKey | JDUOQJGNPOOIMU-UQQQWYQISA-N |
| XLogP | 3.87 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|