C25H23N3O2 — CID 136847275
3-carbazol-9-yl-N-[(Z)-(2-hydroxy-4-prop-2-enylphenyl)methylideneamino]propanamide (PubChem CID 136847275) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-carbazol-9-yl-N-[(Z)-(2-hydroxy-4-prop-2-enylphenyl)methylideneamino]propanamide.
| Compound Name | 3-carbazol-9-yl-N-[(Z)-(2-hydroxy-4-prop-2-enylphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 136847275 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-carbazol-9-yl-N-[(Z)-(2-hydroxy-4-prop-2-enylphenyl)methylideneamino]propanamide |
| SMILES | C=CCc1ccc(/C=N\NC(=O)CCn2c3ccccc3c3ccccc32)c(O)c1 |
| InChI | InChI=1S/C25H23N3O2/c1-2-7-18-12-13-19(24(29)16-18)17-26-27-25(30)14-15-28-22-10-5-3-8-20(22)21-9-4-6-11-23(21)28/h2-6,8-13,16-17,29H,1,7,14-15H2,(H,27,30)/b26-17- |
| InChIKey | GCZPTRSARXHYIK-ONUIUJJFSA-N |
| XLogP | 4.77 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|