C17H15N3O3 — CID 5412914
N-[(Z)-benzylideneamino]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide (PubChem CID 5412914) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is N-[(Z)-benzylideneamino]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide.
| Compound Name | N-[(Z)-benzylideneamino]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 5412914 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[(Z)-benzylideneamino]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide |
| SMILES | O=C(CCn1c(=O)oc2ccccc21)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C17H15N3O3/c21-16(19-18-12-13-6-2-1-3-7-13)10-11-20-14-8-4-5-9-15(14)23-17(20)22/h1-9,12H,10-11H2,(H,19,21)/b18-12- |
| InChIKey | KKBKEISTEOWMCG-PDGQHHTCSA-N |
| XLogP | 2.13 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|