C24H25N3O3 — CID 6864320
methyl 4-[(E)-[3-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoylhydrazinylidene]methyl]benzoate (PubChem CID 6864320) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl 4-[(E)-[3-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoylhydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[3-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoylhydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 6864320 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | methyl 4-[(E)-[3-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoylhydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/NC(=O)CCn2c3c(c4ccccc42)CCCC3)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-30-24(29)18-12-10-17(11-13-18)16-25-26-23(28)14-15-27-21-8-4-2-6-19(21)20-7-3-5-9-22(20)27/h2,4,6,8,10-13,16H,3,5,7,9,14-15H2,1H3,(H,26,28)/b25-16+ |
| InChIKey | BYHWKPUXERTCEM-PCLIKHOPSA-N |
| XLogP | 3.85 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|