C24H20Cl2N4O4 — CID 172676416
2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]-N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]acetamide (PubChem CID 172676416) has the molecular formula C24H20Cl2N4O4 and a molecular weight of 499.35 g/mol. Its IUPAC name is 2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]-N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]-N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 172676416 |
| Molecular Formula | C24H20Cl2N4O4 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]-N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(-c2nc3cc(Cl)c(Cl)cc3n2CC(=O)NN=Cc2ccc(OC)c(O)c2)cc1 |
| InChI | InChI=1S/C24H20Cl2N4O4/c1-33-16-6-4-15(5-7-16)24-28-19-10-17(25)18(26)11-20(19)30(24)13-23(32)29-27-12-14-3-8-22(34-2)21(31)9-14/h3-12,31H,13H2,1-2H3,(H,29,32) |
| InChIKey | LFSKCIYEZQNDRD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|