C20H20N4O4 — CID 127033876
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-(3-methyl-2-oxoquinoxalin-1-yl)acetamide (PubChem CID 127033876) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-(3-methyl-2-oxoquinoxalin-1-yl)acetamide.
| Compound Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-(3-methyl-2-oxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 127033876 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-(3-methyl-2-oxoquinoxalin-1-yl)acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)Cn2c(=O)c(C)nc3ccccc32)cc1OC |
| InChI | InChI=1S/C20H20N4O4/c1-13-20(26)24(16-7-5-4-6-15(16)22-13)12-19(25)23-21-11-14-8-9-17(27-2)18(10-14)28-3/h4-11H,12H2,1-3H3,(H,23,25)/b21-11+ |
| InChIKey | QGORKNBSJRYVKM-SRZZPIQSSA-N |
| XLogP | 1.87 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|