C29H28N6O4 — CID 135650533
2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide (PubChem CID 135650533) has the molecular formula C29H28N6O4 and a molecular weight of 524.58 g/mol. Its IUPAC name is 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135650533 |
| Molecular Formula | C29H28N6O4 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide |
| SMILES | COc1ccc(Cc2nc3ccccc3n2CC(=O)N/N=C/c2c(C)[nH]n(-c3ccccc3)c2=O)cc1OC |
| InChI | InChI=1S/C29H28N6O4/c1-19-22(29(37)35(33-19)21-9-5-4-6-10-21)17-30-32-28(36)18-34-24-12-8-7-11-23(24)31-27(34)16-20-13-14-25(38-2)26(15-20)39-3/h4-15,17,33H,16,18H2,1-3H3,(H,32,36)/b30-17+ |
| InChIKey | FVWCTVMYHAYDTJ-OCSSWDANSA-N |
| XLogP | 3.58 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|