C28H27N5O4 — CID 1388035
2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(2-hydroxy-1-methylindol-3-yl)methylideneamino]acetamide (PubChem CID 1388035) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(2-hydroxy-1-methylindol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(2-hydroxy-1-methylindol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1388035 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(2-hydroxy-1-methylindol-3-yl)methylideneamino]acetamide |
| SMILES | COc1ccc(Cc2nc3ccccc3n2CC(=O)NN=Cc2c(O)n(C)c3ccccc23)cc1OC |
| InChI | InChI=1S/C28H27N5O4/c1-32-22-10-6-4-8-19(22)20(28(32)35)16-29-31-27(34)17-33-23-11-7-5-9-21(23)30-26(33)15-18-12-13-24(36-2)25(14-18)37-3/h4-14,16,35H,15,17H2,1-3H3,(H,31,34) |
| InChIKey | KZNNIOHAPIYGFB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|