C31H30N4O5 — CID 3747069
2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]acetamide (PubChem CID 3747069) has the molecular formula C31H30N4O5 and a molecular weight of 538.60 g/mol. Its IUPAC name is 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]acetamide.
| Compound Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3747069 |
| Molecular Formula | C31H30N4O5 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]acetamide |
| SMILES | COc1ccc(Cc2nc3ccccc3n2CC(=O)NN=Cc2c(O)ccc3oc4c(c23)CCCC4)cc1OC |
| InChI | InChI=1S/C31H30N4O5/c1-38-26-13-11-19(15-28(26)39-2)16-29-33-22-8-4-5-9-23(22)35(29)18-30(37)34-32-17-21-24(36)12-14-27-31(21)20-7-3-6-10-25(20)40-27/h4-5,8-9,11-15,17,36H,3,6-7,10,16,18H2,1-2H3,(H,34,37) |
| InChIKey | CVKGOROFBBGHGB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|