C27H23ClN4O3S — CID 6291179
N-[(Z)-(3-chloro-1-benzothiophen-2-yl)methylideneamino]-2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]acetamide (PubChem CID 6291179) has the molecular formula C27H23ClN4O3S and a molecular weight of 519.03 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-1-benzothiophen-2-yl)methylideneamino]-2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]acetamide.
| Compound Name | N-[(Z)-(3-chloro-1-benzothiophen-2-yl)methylideneamino]-2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 6291179 |
| Molecular Formula | C27H23ClN4O3S |
| Molecular Weight | 519.03 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[(Z)-(3-chloro-1-benzothiophen-2-yl)methylideneamino]-2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]acetamide |
| SMILES | COc1ccc(Cc2nc3ccccc3n2CC(=O)N/N=C\c2sc3ccccc3c2Cl)cc1OC |
| InChI | InChI=1S/C27H23ClN4O3S/c1-34-21-12-11-17(13-22(21)35-2)14-25-30-19-8-4-5-9-20(19)32(25)16-26(33)31-29-15-24-27(28)18-7-3-6-10-23(18)36-24/h3-13,15H,14,16H2,1-2H3,(H,31,33)/b29-15- |
| InChIKey | HVYPSJRNHDKMDZ-FDVSRXAVSA-N |
| XLogP | 5.66 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.03 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|