C29H25N5O6 — CID 3587427
2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(1-hydroxy-4-nitronaphthalen-2-yl)methylideneamino]acetamide (PubChem CID 3587427) has the molecular formula C29H25N5O6 and a molecular weight of 539.55 g/mol. Its IUPAC name is 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(1-hydroxy-4-nitronaphthalen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(1-hydroxy-4-nitronaphthalen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3587427 |
| Molecular Formula | C29H25N5O6 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(1-hydroxy-4-nitronaphthalen-2-yl)methylideneamino]acetamide |
| SMILES | COc1ccc(Cc2nc3ccccc3n2CC(=O)NN=Cc2cc([N+](=O)[O-])c3ccccc3c2O)cc1OC |
| InChI | InChI=1S/C29H25N5O6/c1-39-25-12-11-18(13-26(25)40-2)14-27-31-22-9-5-6-10-23(22)33(27)17-28(35)32-30-16-19-15-24(34(37)38)20-7-3-4-8-21(20)29(19)36/h3-13,15-16,36H,14,17H2,1-2H3,(H,32,35) |
| InChIKey | FKABKTMPNBBBMZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|