C21H20N2O4 — CID 135691005
N-[(E)-(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-2-phenoxyacetamide (PubChem CID 135691005) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-2-phenoxyacetamide.
| Compound Name | N-[(E)-(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 135691005 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[(E)-(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)N/N=C/c1c(O)ccc2oc3c(c12)CCCC3 |
| InChI | InChI=1S/C21H20N2O4/c24-17-10-11-19-21(15-8-4-5-9-18(15)27-19)16(17)12-22-23-20(25)13-26-14-6-2-1-3-7-14/h1-3,6-7,10-12,24H,4-5,8-9,13H2,(H,23,25)/b22-12+ |
| InChIKey | NFZQDPCDPPEWTI-WSDLNYQXSA-N |
| XLogP | 3.55 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|