C17H12F2N4O3S — CID 168577731
N-[[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168577731) has the molecular formula C17H12F2N4O3S and a molecular weight of 390.37 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577731 |
| Molecular Formula | C17H12F2N4O3S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(OC(F)F)c(C=NNc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C17H12F2N4O3S/c18-16(19)26-15-7-6-13(23(24)25)8-12(15)9-20-22-17-21-14(10-27-17)11-4-2-1-3-5-11/h1-10,16H,(H,21,22) |
| InChIKey | AVNRYQDDNBCMFU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|