C16H10Cl2N4O2S — CID 168577401
N-[(3,5-dichloro-2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168577401) has the molecular formula C16H10Cl2N4O2S and a molecular weight of 393.26 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(3,5-dichloro-2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577401 |
| Molecular Formula | C16H10Cl2N4O2S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | N-[(3,5-dichloro-2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1c(Cl)cc(Cl)cc1C=NNc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H10Cl2N4O2S/c17-12-6-11(15(22(23)24)13(18)7-12)8-19-21-16-20-14(9-25-16)10-4-2-1-3-5-10/h1-9H,(H,20,21) |
| InChIKey | IAZLQWKKDRTXER-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|