C17H14BrN5O4 — CID 4613385
1-[2-[2-(4-bromophenoxy)ethoxy]-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 4613385) has the molecular formula C17H14BrN5O4 and a molecular weight of 432.23 g/mol. Its IUPAC name is 1-[2-[2-(4-bromophenoxy)ethoxy]-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-[2-[2-(4-bromophenoxy)ethoxy]-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 4613385 |
| Molecular Formula | C17H14BrN5O4 |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 1-[2-[2-(4-bromophenoxy)ethoxy]-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(OCCOc2ccc(Br)cc2)c(C=Nn2cnnc2)c1 |
| InChI | InChI=1S/C17H14BrN5O4/c18-14-1-4-16(5-2-14)26-7-8-27-17-6-3-15(23(24)25)9-13(17)10-21-22-11-19-20-12-22/h1-6,9-12H,7-8H2 |
| InChIKey | FGGVPWSRDQXHIW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|