C20H21ClN4O3 — CID 2241166
1-[5-chloro-2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 2241166) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is 1-[5-chloro-2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-[5-chloro-2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 2241166 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[5-chloro-2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1ccc(OCCOCCOc2ccc(Cl)cc2C=Nn2cnnc2)cc1 |
| InChI | InChI=1S/C20H21ClN4O3/c1-16-2-5-19(6-3-16)27-10-8-26-9-11-28-20-7-4-18(21)12-17(20)13-24-25-14-22-23-15-25/h2-7,12-15H,8-11H2,1H3 |
| InChIKey | DQMCYCGYRYDRGQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|