C21H22Cl2N4O2 — CID 6897918
(E)-1-[2-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6897918) has the molecular formula C21H22Cl2N4O2 and a molecular weight of 433.34 g/mol. Its IUPAC name is (E)-1-[2-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-[2-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6897918 |
| Molecular Formula | C21H22Cl2N4O2 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (E)-1-[2-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | CC(C)(C)c1ccc(OCCOc2c(Cl)cc(Cl)cc2/C=N/n2cnnc2)cc1 |
| InChI | InChI=1S/C21H22Cl2N4O2/c1-21(2,3)16-4-6-18(7-5-16)28-8-9-29-20-15(10-17(22)11-19(20)23)12-26-27-13-24-25-14-27/h4-7,10-14H,8-9H2,1-3H3/b26-12+ |
| InChIKey | DIDRWKWNKRMPHQ-RPPGKUMJSA-N |
| XLogP | 5.22 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|