C16H10Cl4N4O — CID 4247445
1-[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 4247445) has the molecular formula C16H10Cl4N4O and a molecular weight of 416.10 g/mol. Its IUPAC name is 1-[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 4247445 |
| Molecular Formula | C16H10Cl4N4O |
| Molecular Weight | 416.10 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | 1-[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Clc1ccc(COc2c(Cl)cc(Cl)cc2C=Nn2cnnc2)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl4N4O/c17-12-2-1-10(14(19)4-12)7-25-16-11(3-13(18)5-15(16)20)6-23-24-8-21-22-9-24/h1-6,8-9H,7H2 |
| InChIKey | XFRZUKSYVYLNSL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.10 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|