C21H20N6O3S — CID 126117747
2-(3,4-dimethylanilino)-N-[(E)-(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)methylideneamino]acetamide (PubChem CID 126117747) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-N-[(E)-(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,4-dimethylanilino)-N-[(E)-(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126117747 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-(3,4-dimethylanilino)-N-[(E)-(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(NCC(=O)N/N=C/c2cc([N+](=O)[O-])ccc2Sc2ncccn2)cc1C |
| InChI | InChI=1S/C21H20N6O3S/c1-14-4-5-17(10-15(14)2)24-13-20(28)26-25-12-16-11-18(27(29)30)6-7-19(16)31-21-22-8-3-9-23-21/h3-12,24H,13H2,1-2H3,(H,26,28)/b25-12+ |
| InChIKey | CGJAYODVRDREFP-BRJLIKDPSA-N |
| XLogP | 3.72 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|