C9H3ClN4O3 — CID 154210954
5-(2-chloro-4-nitrophenyl)-1,3,4-oxadiazole-2-carbonitrile (PubChem CID 154210954) has the molecular formula C9H3ClN4O3 and a molecular weight of 250.60 g/mol. Its IUPAC name is 5-(2-chloro-4-nitrophenyl)-1,3,4-oxadiazole-2-carbonitrile.
| Compound Name | 5-(2-chloro-4-nitrophenyl)-1,3,4-oxadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 154210954 |
| Molecular Formula | C9H3ClN4O3 |
| Molecular Weight | 250.60 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 5-(2-chloro-4-nitrophenyl)-1,3,4-oxadiazole-2-carbonitrile |
| SMILES | N#Cc1nnc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C9H3ClN4O3/c10-7-3-5(14(15)16)1-2-6(7)9-13-12-8(4-11)17-9/h1-3H |
| InChIKey | YPDZAYAPKLUSIG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 105.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.60 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|