About 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide
1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide (PubChem CID 144972005) has the molecular formula C14H13ClN2O3
and a molecular weight of 292.72 g/mol. Its IUPAC name is 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide.
Molecular Properties
| Compound Name | 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide |
| PubChem CID | 144972005 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide |
| SMILES | Cc1ccc(-c2cc([N+](=O)[O-])ccc2Cl)cc1.NC=O |
| InChI | InChI=1S/C13H10ClNO2.CH3NO/c1-9-2-4-10(5-3-9)12-8-11(15(16)17)6-7-13(12)14;2-1-3/h2-8H,1H3;1H,(H2,2,3) |
| InChIKey | PLBXZFWIWFNYSV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide?
The IUPAC name of 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide (CID 144972005) is 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide.
What is the SMILES notation for 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide?
The canonical SMILES for 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide is Cc1ccc(-c2cc([N+](=O)[O-])ccc2Cl)cc1.NC=O.
What is the InChIKey of 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide?
The InChIKey is PLBXZFWIWFNYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO2.CH3NO/c1-9-2-4-10(5-3-9)12-8-11(15(16)17)6-7-13(12)14;2-1-3/h2-8H,1H3;1H,(H2,2,3).
What are the key properties of 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide?
1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide has a molecular weight of 292.72 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(4-methylphenyl)-4-nitrobenzene;formamide is sourced from PubChem (CID 144972005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).