About 5-nitro-2-(1,2-oxazol-5-yl)phenol
5-nitro-2-(1,2-oxazol-5-yl)phenol (PubChem CID 135445335) has the molecular formula C9H6N2O4
and a molecular weight of 206.16 g/mol. Its IUPAC name is 5-nitro-2-(1,2-oxazol-5-yl)phenol.
Molecular Properties
| Compound Name | 5-nitro-2-(1,2-oxazol-5-yl)phenol |
| PubChem CID | 135445335 |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 5-nitro-2-(1,2-oxazol-5-yl)phenol |
| SMILES | O=[N+]([O-])c1ccc(-c2ccno2)c(O)c1 |
| InChI | InChI=1S/C9H6N2O4/c12-8-5-6(11(13)14)1-2-7(8)9-3-4-10-15-9/h1-5,12H |
| InChIKey | OAMASYCRWJIJDT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-(1,2-oxazol-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-(1,2-oxazol-5-yl)phenol?
The IUPAC name of 5-nitro-2-(1,2-oxazol-5-yl)phenol (CID 135445335) is 5-nitro-2-(1,2-oxazol-5-yl)phenol.
What is the SMILES notation for 5-nitro-2-(1,2-oxazol-5-yl)phenol?
The canonical SMILES for 5-nitro-2-(1,2-oxazol-5-yl)phenol is O=[N+]([O-])c1ccc(-c2ccno2)c(O)c1.
What is the InChIKey of 5-nitro-2-(1,2-oxazol-5-yl)phenol?
The InChIKey is OAMASYCRWJIJDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O4/c12-8-5-6(11(13)14)1-2-7(8)9-3-4-10-15-9/h1-5,12H.
What are the key properties of 5-nitro-2-(1,2-oxazol-5-yl)phenol?
5-nitro-2-(1,2-oxazol-5-yl)phenol has a molecular weight of 206.16 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-(1,2-oxazol-5-yl)phenol is sourced from PubChem (CID 135445335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).