About 5-nitro-1,2-benzoxazol-7-ol
5-nitro-1,2-benzoxazol-7-ol (PubChem CID 119091704) has the molecular formula C7H4N2O4
and a molecular weight of 180.12 g/mol. Its IUPAC name is 5-nitro-1,2-benzoxazol-7-ol.
Molecular Properties
| Compound Name | 5-nitro-1,2-benzoxazol-7-ol |
| PubChem CID | 119091704 |
| Molecular Formula | C7H4N2O4 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 5-nitro-1,2-benzoxazol-7-ol |
| SMILES | O=[N+]([O-])c1cc(O)c2oncc2c1 |
| InChI | InChI=1S/C7H4N2O4/c10-6-2-5(9(11)12)1-4-3-8-13-7(4)6/h1-3,10H |
| InChIKey | DHVGZTABXRYBQG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1,2-benzoxazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1,2-benzoxazol-7-ol?
The IUPAC name of 5-nitro-1,2-benzoxazol-7-ol (CID 119091704) is 5-nitro-1,2-benzoxazol-7-ol.
What is the SMILES notation for 5-nitro-1,2-benzoxazol-7-ol?
The canonical SMILES for 5-nitro-1,2-benzoxazol-7-ol is O=[N+]([O-])c1cc(O)c2oncc2c1.
What is the InChIKey of 5-nitro-1,2-benzoxazol-7-ol?
The InChIKey is DHVGZTABXRYBQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O4/c10-6-2-5(9(11)12)1-4-3-8-13-7(4)6/h1-3,10H.
What are the key properties of 5-nitro-1,2-benzoxazol-7-ol?
5-nitro-1,2-benzoxazol-7-ol has a molecular weight of 180.12 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1,2-benzoxazol-7-ol is sourced from PubChem (CID 119091704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).