About 2-bromo-5-nitrophenol;ethane
2-bromo-5-nitrophenol;ethane (PubChem CID 177010307) has the molecular formula C8H10BrNO3
and a molecular weight of 248.08 g/mol. Its IUPAC name is 2-bromo-5-nitrophenol;ethane.
Molecular Properties
| Compound Name | 2-bromo-5-nitrophenol;ethane |
| PubChem CID | 177010307 |
| Molecular Formula | C8H10BrNO3 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 2-bromo-5-nitrophenol;ethane |
| SMILES | CC.O=[N+]([O-])c1ccc(Br)c(O)c1 |
| InChI | InChI=1S/C6H4BrNO3.C2H6/c7-5-2-1-4(8(10)11)3-6(5)9;1-2/h1-3,9H;1-2H3 |
| InChIKey | WOJPXKOLWPJPBS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-nitrophenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-nitrophenol;ethane?
The IUPAC name of 2-bromo-5-nitrophenol;ethane (CID 177010307) is 2-bromo-5-nitrophenol;ethane.
What is the SMILES notation for 2-bromo-5-nitrophenol;ethane?
The canonical SMILES for 2-bromo-5-nitrophenol;ethane is CC.O=[N+]([O-])c1ccc(Br)c(O)c1.
What is the InChIKey of 2-bromo-5-nitrophenol;ethane?
The InChIKey is WOJPXKOLWPJPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrNO3.C2H6/c7-5-2-1-4(8(10)11)3-6(5)9;1-2/h1-3,9H;1-2H3.
What are the key properties of 2-bromo-5-nitrophenol;ethane?
2-bromo-5-nitrophenol;ethane has a molecular weight of 248.08 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-nitrophenol;ethane is sourced from PubChem (CID 177010307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).