C10H5ClN4O3S — CID 80606130
4-[(5-chloro-1,3,4-thiadiazol-2-yl)methoxy]-3-nitrobenzonitrile (PubChem CID 80606130) has the molecular formula C10H5ClN4O3S and a molecular weight of 296.70 g/mol. Its IUPAC name is 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methoxy]-3-nitrobenzonitrile.
| Compound Name | 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methoxy]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 80606130 |
| Molecular Formula | C10H5ClN4O3S |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methoxy]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(OCc2nnc(Cl)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H5ClN4O3S/c11-10-14-13-9(19-10)5-18-8-2-1-6(4-12)3-7(8)15(16)17/h1-3H,5H2 |
| InChIKey | GJRKHCUBUKWTJQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 101.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|