C12H13N3O3S2 — CID 56791153
2-[(4-ethyl-2-nitrophenoxy)methyl]-5-methylsulfanyl-1,3,4-thiadiazole (PubChem CID 56791153) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-[(4-ethyl-2-nitrophenoxy)methyl]-5-methylsulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-[(4-ethyl-2-nitrophenoxy)methyl]-5-methylsulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 56791153 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-[(4-ethyl-2-nitrophenoxy)methyl]-5-methylsulfanyl-1,3,4-thiadiazole |
| SMILES | CCc1ccc(OCc2nnc(SC)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13N3O3S2/c1-3-8-4-5-10(9(6-8)15(16)17)18-7-11-13-14-12(19-2)20-11/h4-6H,3,7H2,1-2H3 |
| InChIKey | FLGYPAAWKRQTCE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|