C12H10Cl2N4O3 — CID 80664200
2-[(2,6-dichloro-4-nitrophenoxy)methyl]-6-methylpyrimidin-4-amine (PubChem CID 80664200) has the molecular formula C12H10Cl2N4O3 and a molecular weight of 329.14 g/mol. Its IUPAC name is 2-[(2,6-dichloro-4-nitrophenoxy)methyl]-6-methylpyrimidin-4-amine.
| Compound Name | 2-[(2,6-dichloro-4-nitrophenoxy)methyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80664200 |
| Molecular Formula | C12H10Cl2N4O3 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[(2,6-dichloro-4-nitrophenoxy)methyl]-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(COc2c(Cl)cc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C12H10Cl2N4O3/c1-6-2-10(15)17-11(16-6)5-21-12-8(13)3-7(18(19)20)4-9(12)14/h2-4H,5H2,1H3,(H2,15,16,17) |
| InChIKey | KZSNIBPSGJOWTE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|