C12H13Cl2N3O — CID 3051323
2-[(3-chlorophenoxy)methyl]-6-methylpyrimidin-4-amine;hydrochloride (PubChem CID 3051323) has the molecular formula C12H13Cl2N3O and a molecular weight of 286.16 g/mol. Its IUPAC name is 2-[(3-chlorophenoxy)methyl]-6-methylpyrimidin-4-amine;hydrochloride.
| Compound Name | 2-[(3-chlorophenoxy)methyl]-6-methylpyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 3051323 |
| Molecular Formula | C12H13Cl2N3O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-[(3-chlorophenoxy)methyl]-6-methylpyrimidin-4-amine;hydrochloride |
| SMILES | Cc1cc(N)nc(COc2cccc(Cl)c2)n1.Cl |
| InChI | InChI=1S/C12H12ClN3O.ClH/c1-8-5-11(14)16-12(15-8)7-17-10-4-2-3-9(13)6-10;/h2-6H,7H2,1H3,(H2,14,15,16);1H |
| InChIKey | RPRWCSCXFZMYEZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |