C11H16Cl2N2 — CID 106993484
N-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylpropan-2-amine (PubChem CID 106993484) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is N-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylpropan-2-amine.
| Compound Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 106993484 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylpropan-2-amine |
| SMILES | CCN(Cc1ccc(Cl)nc1Cl)C(C)C |
| InChI | InChI=1S/C11H16Cl2N2/c1-4-15(8(2)3)7-9-5-6-10(12)14-11(9)13/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | NLJXUUPFCQIZCU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|