C14H13Cl3N2 — CID 106993559
1-(3-chlorophenyl)-N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methylmethanamine (PubChem CID 106993559) has the molecular formula C14H13Cl3N2 and a molecular weight of 315.63 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methylmethanamine.
| Compound Name | 1-(3-chlorophenyl)-N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 106993559 |
| Molecular Formula | C14H13Cl3N2 |
| Molecular Weight | 315.63 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methylmethanamine |
| SMILES | CN(Cc1cccc(Cl)c1)Cc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C14H13Cl3N2/c1-19(8-10-3-2-4-12(15)7-10)9-11-5-6-13(16)18-14(11)17/h2-7H,8-9H2,1H3 |
| InChIKey | REDCRNCUJUXDDZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|