C15H15Cl3N2O — CID 87686392
2-(3-chlorophenyl)-2-[(2,6-dichloro-3-pyridinyl)methyl-methylamino]ethanol (PubChem CID 87686392) has the molecular formula C15H15Cl3N2O and a molecular weight of 345.66 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-[(2,6-dichloro-3-pyridinyl)methyl-methylamino]ethanol.
| Compound Name | 2-(3-chlorophenyl)-2-[(2,6-dichloro-3-pyridinyl)methyl-methylamino]ethanol |
|---|---|
| PubChem CID | 87686392 |
| Molecular Formula | C15H15Cl3N2O |
| Molecular Weight | 345.66 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-(3-chlorophenyl)-2-[(2,6-dichloro-3-pyridinyl)methyl-methylamino]ethanol |
| SMILES | CN(Cc1ccc(Cl)nc1Cl)C(CO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H15Cl3N2O/c1-20(8-11-5-6-14(17)19-15(11)18)13(9-21)10-3-2-4-12(16)7-10/h2-7,13,21H,8-9H2,1H3 |
| InChIKey | PAUVASWQZRSRSG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|